CAS 898775-78-5

1-(4-Fluorophenyl)-3-(4-methoxyphenyl)-1-propanone

Description:

1-(4-Fluorophenyl)-3-(4-methoxyphenyl)-1-propanone, also known by its CAS number 898775-78-5, is an organic compound characterized by its ketone functional group and the presence of both fluorine and methoxy substituents on the aromatic rings. This compound features a propanone backbone, which contributes to its reactivity and potential applications in organic synthesis. The fluorine atom enhances the compound's lipophilicity and may influence its biological activity, while the methoxy group can affect its electronic properties and solubility. Typically, compounds of this nature are studied for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of multiple aromatic rings suggests that it may exhibit interesting photophysical properties, making it a candidate for further research in materials science or medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on the compound's behavior in various conditions.

Formula: C₁₆H₁₅FO₂

InChI: InChI=1S/C16H15FO2/c1-19-15-9-2-12(3-10-15)4-11-16(18)13-5-7-14(17)8-6-13/h2-3,5-10H,4,11H2,1H3

InChI key: InChIKey=RTKSWYJVSFPGLT-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(OC)C=C1)(=O)C2=CC=C(F)C=C2

Synonyms:

• 1-(4-Fluorophenyl)-3-(4-methoxyphenyl)-1-propanone
• 1-Propanone, 1-(4-fluorophenyl)-3-(4-methoxyphenyl)-