CAS 898775-85-4

Ethyl ζ-oxo-4-(1-piperidinylmethyl)benzeneheptanoate

Description:

Ethyl ζ-oxo-4-(1-piperidinylmethyl)benzeneheptanoate, identified by its CAS number 898775-85-4, is a chemical compound that belongs to the class of esters. It features a complex structure that includes a benzene ring substituted with a piperidinylmethyl group and a heptanoate moiety. The presence of the piperidine ring suggests potential pharmacological activity, as piperidine derivatives are often associated with various biological effects. The compound's ester functional group indicates that it can undergo hydrolysis to yield the corresponding acid and alcohol, which may influence its reactivity and solubility in different solvents. Additionally, the presence of the keto group (ζ-oxo) may contribute to its reactivity in various organic reactions, such as nucleophilic additions. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.

Formula: C₂₁H₃₁NO₃

InChI: InChI=1S/C21H31NO3/c1-2-25-21(24)10-6-3-5-9-20(23)19-13-11-18(12-14-19)17-22-15-7-4-8-16-22/h11-14H,2-10,15-17H2,1H3

InChI key: InChIKey=KJMIEQBDETXVBG-UHFFFAOYSA-N

SMILES: C(CCCCCC(OCC)=O)(=O)C1=CC=C(CN2CCCCC2)C=C1

Synonyms:

• Ethyl ζ-oxo-4-(1-piperidinylmethyl)benzeneheptanoate
• Benzeneheptanoic acid, ζ-oxo-4-(1-piperidinylmethyl)-, ethyl ester

ethyl 7-oxo-7-[4-(piperidinomethyl)phenyl]heptanoate

CAS: 898775-85-4

Formula: C₂₁H₃₁NO₃

Purity: 97.0%

Molecular weight: 345.483

Ref: 10-F204311