CymitQuimica logo

CAS 898775-89-8

:

phenyl-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:
Phenyl-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, identified by its CAS number 898775-89-8, is an organic compound characterized by its complex structure that includes a phenyl group and a pyrrolidine moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the pyrrolidine ring suggests that it may exhibit interesting pharmacological properties, as pyrrolidine derivatives are often associated with various biological activities. The compound's molecular structure allows for potential interactions with biological targets, making it a candidate for research in medicinal chemistry. Additionally, its solubility and stability in various solvents can influence its behavior in chemical reactions and applications. Overall, phenyl-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone represents a versatile scaffold for further exploration in both synthetic and medicinal chemistry contexts.
Formula:C18H19NO
InChI:InChI=1/C18H19NO/c20-18(16-6-2-1-3-7-16)17-10-8-15(9-11-17)14-19-12-4-5-13-19/h1-3,6-11H,4-5,12-14H2
SMILES:c1ccc(cc1)C(=O)c1ccc(cc1)CN1CCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.