CAS 898775-91-2

Methanone, (2-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a pyrrolidine moiety indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can influence its solubility and permeability in biological systems. The methyl group on the 2-position of one phenyl ring may affect its electronic properties and steric hindrance, potentially impacting its reactivity and interaction with biological targets. Additionally, the pyrrolidine ring suggests that the compound may engage in hydrogen bonding and other interactions, which are crucial for its biological activity. Overall, this compound's unique structural features may contribute to its potential as a lead compound in drug discovery or as a research tool in various chemical and biological studies.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-15-6-2-3-7-18(15)19(21)17-10-8-16(9-11-17)14-20-12-4-5-13-20/h2-3,6-11H,4-5,12-14H2,1H3

InChI key: InChIKey=LRULAXYCVLUNAR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• 2-Methyl-4′-pyrrolidinomethyl benzophenone
• Methanone, (2-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• (2-Methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone

2-methyl-4′-pyrrolidinomethyl benzophenone

CAS: 898775-91-2

Formula: C₁₉H₂₁NO

Purity: 97.0%

Molecular weight: 279.383

Ref: 10-F204314