CAS 898775-93-4

Methanone, (3-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a pyrrolidine moiety indicates that it has potential applications in medicinal chemistry, particularly in the development of psychoactive substances or pharmaceuticals. The compound features a 3-methylphenyl group and a 4-(1-pyrrolidinylmethyl)phenyl group, contributing to its unique chemical properties and potential biological activity. Its molecular structure suggests that it may exhibit lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups may allow for various interactions with biological targets, making it a candidate for further research in drug development. As with many compounds of this nature, safety and toxicity assessments are essential for understanding its potential effects in biological systems. Overall, this compound exemplifies the complexity and diversity of organic molecules in the field of chemistry.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-15-5-4-6-18(13-15)19(21)17-9-7-16(8-10-17)14-20-11-2-3-12-20/h4-10,13H,2-3,11-12,14H2,1H3

InChI key: InChIKey=MIMNIWBEFNDTGJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=CC=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• Methanone, (3-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• 3-Methyl-4′-pyrrolidinomethyl benzophenone
• (3-Methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone

3-methyl-4′-pyrrolidinomethyl benzophenone

CAS: 898775-93-4

Formula: C₁₉H₂₁NO

Purity: 97.0%

Molecular weight: 279.383

Ref: 10-F204315