CAS 898775-95-6

Methanone, (4-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (4-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a pyrrolidine moiety indicates that it has potential applications in medicinal chemistry, particularly in the development of psychoactive substances or pharmaceuticals. The compound features a 4-methylphenyl group, which contributes to its hydrophobic characteristics, while the pyrrolidinylmethyl substituent may enhance its interaction with biological targets. This compound is likely to exhibit moderate to high lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can affect its binding affinity to various receptors. As with many organic compounds, its stability, reactivity, and biological activity would depend on environmental conditions such as pH and temperature. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-15-4-8-17(9-5-15)19(21)18-10-6-16(7-11-18)14-20-12-2-3-13-20/h4-11H,2-3,12-14H2,1H3

InChI key: InChIKey=YTFCJRMAWOOWPC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(C)C=C3

Synonyms:

• (4-Methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone
• 4-Methyl-4′-pyrrolidinomethyl benzophenone
• Methanone, (4-methylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

4-methyl-4′-pyrrolidinomethyl benzophenone

CAS: 898775-95-6

Formula: C₁₉H₂₁NO

Purity: 97.0%

Molecular weight: 279.383

Ref: 10-F204316