CymitQuimica logo

CAS 898775-96-7

:

1-(3-chloro-4-fluoro-phenyl)-3-(4-methoxyphenyl)propan-1-one

Description:
1-(3-Chloro-4-fluoro-phenyl)-3-(4-methoxyphenyl)propan-1-one, identified by its CAS number 898775-96-7, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a chloro and a fluoro group on one phenyl ring and a methoxy group on another. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding. The presence of halogen substituents (chlorine and fluorine) can influence its reactivity and lipophilicity, potentially enhancing its biological activity. The methoxy group contributes to the compound's overall electron-donating character, which may affect its interaction with biological targets. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C16H14ClFO2
InChI:InChI=1/C16H14ClFO2/c1-20-13-6-2-11(3-7-13)4-9-16(19)12-5-8-15(18)14(17)10-12/h2-3,5-8,10H,4,9H2,1H3
SMILES:COc1ccc(cc1)CCC(=O)c1ccc(c(c1)Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.