CAS 898775-98-9

1-Propanone, 1-(2-chlorophenyl)-3-(4-methoxyphenyl)-

Description:

1-Propanone, 1-(2-chlorophenyl)-3-(4-methoxyphenyl)-, also known by its CAS number 898775-98-9, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2-chlorophenyl group and a 4-methoxyphenyl group. The presence of the chlorine atom introduces electronegativity, which can influence the compound's reactivity and polarity. The methoxy group, being an electron-donating substituent, can enhance the compound's stability and affect its solubility in various solvents. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structures, which can impact their biological activity and potential applications in pharmaceuticals or agrochemicals. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Overall, the unique combination of functional groups and structural features contributes to its chemical behavior and potential utility in various fields.

Formula: C₁₆H₁₅ClO₂

InChI: InChI=1S/C16H15ClO2/c1-19-13-9-6-12(7-10-13)8-11-16(18)14-4-2-3-5-15(14)17/h2-7,9-10H,8,11H2,1H3

InChI key: InChIKey=LRJBOEHCOVYEEZ-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(Cl)C=CC=C1)C2=CC=C(OC)C=C2

Synonyms:

• 1-(2-Chlorophenyl)-3-(4-methoxyphenyl)propan-1-one
• 2′-Chloro-3-(4-methoxyphenyl)propiophenone
• 1-Propanone, 1-(2-chlorophenyl)-3-(4-methoxyphenyl)-