CAS 898776-03-9

2-[4-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

Description:

2-[4-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile, with the CAS number 898776-03-9, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a benzonitrile moiety. This compound features a pyrrolidine ring, which contributes to its potential biological activity. The presence of both the benzoyl and benzonitrile functionalities suggests that it may exhibit interesting interactions with biological targets, possibly influencing its pharmacological properties. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the presence of aromatic rings that can engage in π-π stacking interactions. Its molecular structure may allow for various functionalization possibilities, making it a candidate for further research in medicinal chemistry. Additionally, the presence of the nitrile group may impart unique reactivity, potentially allowing for further derivatization. Overall, this compound's unique structural features position it as a subject of interest in the fields of organic synthesis and drug development.

Formula: C₁₉H₁₈N₂O

InChI: InChI=1S/C19H18N2O/c20-13-17-5-1-2-6-18(17)19(22)16-9-7-15(8-10-16)14-21-11-3-4-12-21/h1-2,5-10H,3-4,11-12,14H2

InChI key: InChIKey=KWYGGQMGYABEIV-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C#N)C=CC=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• 2-[4-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile
• Benzonitrile, 2-[4-(1-pyrrolidinylmethyl)benzoyl]-

2-cyano-4′-pyrrolidinomethyl benzophenone

CAS: 898776-03-9

Formula: C₁₉H₁₈N₂O

Purity: 97.0%

Molecular weight: 290.366

Ref: 10-F204320