CAS 898776-06-2

Ethyl ζ-oxocyclopentaneheptanoate

Description:

Ethyl ζ-oxocyclopentaneheptanoate, identified by its CAS number 898776-06-2, is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethyl alcohol) and a carboxylic acid. This compound features a cyclopentane ring, which contributes to its cyclic structure, and a heptanoate chain, indicating that it has a seven-carbon backbone. The presence of the oxo group (a carbonyl group) at the ζ position adds to its reactivity and potential applications in organic synthesis. Ethyl ζ-oxocyclopentaneheptanoate may exhibit properties typical of esters, such as being relatively non-polar, having a pleasant fruity odor, and being soluble in organic solvents. Its unique structure suggests potential uses in the synthesis of pharmaceuticals, agrochemicals, or as a flavoring agent. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. Safety data should also be consulted to understand any hazards associated with handling this compound.

Formula: C₁₄H₂₄O₃

InChI: InChI=1S/C14H24O3/c1-2-17-14(16)11-5-3-4-10-13(15)12-8-6-7-9-12/h12H,2-11H2,1H3

InChI key: InChIKey=TXTQFLHBELAXFG-UHFFFAOYSA-N

SMILES: C(CCCCCC(OCC)=O)(=O)C1CCCC1

Synonyms:

• Ethyl ζ-oxocyclopentaneheptanoate
• Cyclopentaneheptanoic acid, ζ-oxo-, ethyl ester