CAS 898776-07-3

1-Propanone, 3-(4-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(4-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a methoxyphenyl group and a trifluoromethylphenyl group. The presence of the methoxy group enhances its electron-donating properties, while the trifluoromethyl group is known for its strong electron-withdrawing characteristics, influencing the compound's reactivity and stability. The molecular structure contributes to its potential applications in various fields, including pharmaceuticals and materials science. Additionally, the compound's unique combination of functional groups may impart specific physical properties, such as solubility and boiling point, which are important for its practical uses. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorinated groups, which can pose environmental and health risks. Overall, this compound exemplifies the complexity and versatility of organic chemistry in synthesizing molecules with tailored properties.

Formula: C₁₇H₁₅F₃O₂

InChI: InChI=1S/C17H15F3O2/c1-22-15-9-2-12(3-10-15)4-11-16(21)13-5-7-14(8-6-13)17(18,19)20/h2-3,5-10H,4,11H2,1H3

InChI key: InChIKey=OUOPXCDUOSRKHJ-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(OC)C=C1)(=O)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 1-Propanone, 3-(4-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]-
• 3-(4-Methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]-1-propanone