CymitQuimica logo

CAS 898776-08-4

:

4-[4-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

Description:
4-[4-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile, with the CAS number 898776-08-4, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The pyrrolidine ring contributes to its potential biological activity, possibly influencing its interaction with biological targets. The presence of the nitrile group may enhance its lipophilicity and affect its solubility in organic solvents. Additionally, this compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of designing compounds that interact with specific receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation to elucidate its pharmacological properties.
Formula:C19H18N2O
InChI:InChI=1S/C19H18N2O/c20-13-15-3-7-17(8-4-15)19(22)18-9-5-16(6-10-18)14-21-11-1-2-12-21/h3-10H,1-2,11-12,14H2
InChI key:InChIKey=PDOJYUJHYROZFM-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(C#N)C=C3
Synonyms:
  • 4-[4-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile
  • Benzonitrile, 4-[4-(1-pyrrolidinylmethyl)benzoyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.