CAS 898776-10-8

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-methoxyphenyl)-

Description:

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-methoxyphenyl)-, also known by its CAS number 898776-10-8, is an organic compound characterized by its ketone functional group. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromo-2-fluorophenyl group and a 4-methoxyphenyl group. The presence of bromine and fluorine atoms introduces halogen substituents that can influence the compound's reactivity and polarity, while the methoxy group contributes to its overall electronic properties. The molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis due to its unique functional groups. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by the steric and electronic effects of the substituents. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose health risks.

Formula: C₁₆H₁₄BrFO₂

InChI: InChI=1S/C16H14BrFO2/c1-20-13-6-2-11(3-7-13)4-9-16(19)14-8-5-12(17)10-15(14)18/h2-3,5-8,10H,4,9H2,1H3

InChI key: InChIKey=JOOPCUHVEZXJRE-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(OC)C=C1)(=O)C2=C(F)C=C(Br)C=C2

Synonyms:

• 1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-methoxyphenyl)-
• 1-(4-Bromo-2-fluorophenyl)-3-(4-methoxyphenyl)-1-propanone
• 4′-Bromo-2′-fluoro-3-(4-methoxyphenyl)propiophenone

4′-bromo-2′-fluoro-3-(4-methoxyphenyl)propiophenone

CAS: 898776-10-8

Formula: C₁₆H₁₄BrFO₂

Purity: 97.0%

Molecular weight: 337.188

Ref: 10-F205917