CymitQuimica logo

CAS 898776-13-1

:

1-(2-chloro-4-fluoro-phenyl)-3-(4-methoxyphenyl)propan-1-one

Description:
1-(2-Chloro-4-fluoro-phenyl)-3-(4-methoxyphenyl)propan-1-one, with the CAS number 898776-13-1, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a chloro and a fluoro group on one phenyl ring and a methoxy group on another. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding. The presence of halogen substituents (chlorine and fluorine) can influence its reactivity and lipophilicity, potentially enhancing its biological activity. The methoxy group contributes to the electron-donating character, which can affect the compound's overall electronic properties and stability. Such compounds may be of interest in medicinal chemistry for their potential pharmacological activities, including anti-inflammatory or anticancer properties, although specific biological data would be necessary to confirm such effects. Overall, the unique combination of substituents in this compound suggests a diverse range of chemical behaviors and potential applications in various fields.
Formula:C16H14ClFO2
InChI:InChI=1/C16H14ClFO2/c1-20-13-6-2-11(3-7-13)4-9-16(19)14-8-5-12(18)10-15(14)17/h2-3,5-8,10H,4,9H2,1H3
SMILES:COc1ccc(cc1)CCC(=O)c1ccc(cc1Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.