CAS 898776-19-7
:1-Propanone, 1-(4-chloro-2-fluorophenyl)-3-(4-methoxyphenyl)-
Description:
1-Propanone, 1-(4-chloro-2-fluorophenyl)-3-(4-methoxyphenyl)-, also known by its CAS number 898776-19-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-chloro-2-fluorophenyl group and a 4-methoxyphenyl group. The presence of halogen atoms, such as chlorine and fluorine, often influences the compound's reactivity and physical properties, including its boiling and melting points, solubility, and potential biological activity. The methoxy group can enhance the compound's lipophilicity, affecting its interaction with biological systems. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and reductions. This compound's unique structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C16H14ClFO2
InChI:InChI=1S/C16H14ClFO2/c1-20-13-6-2-11(3-7-13)4-9-16(19)14-8-5-12(17)10-15(14)18/h2-3,5-8,10H,4,9H2,1H3
InChI key:InChIKey=FURZFISHIKPZFO-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(OC)C=C1)(=O)C2=C(F)C=C(Cl)C=C2
Synonyms:- 1-Propanone, 1-(4-chloro-2-fluorophenyl)-3-(4-methoxyphenyl)-
- 1-(4-Chloro-2-fluorophenyl)-3-(4-methoxyphenyl)propan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.