CAS 898776-20-0
:(2-methylsulfanylphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (2-methylsulfanylphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898776-20-0, is a synthetic organic compound characterized by its complex molecular structure. It features a methanone functional group, which is indicative of ketones, and incorporates both a methylthio group and a pyrrolidine moiety. The presence of the methylthio group suggests potential for increased lipophilicity, which may influence its solubility and biological activity. The pyrrolidine ring contributes to the compound's potential pharmacological properties, as it is often associated with various biological activities. This compound may exhibit interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its structural complexity suggests that it could be investigated for various applications, including as a potential therapeutic agent. However, specific data regarding its physical properties, reactivity, and biological effects would require further empirical studies to elucidate its full profile.
Formula:C19H21NOS
InChI:InChI=1/C19H21NOS/c1-22-18-7-3-2-6-17(18)19(21)16-10-8-15(9-11-16)14-20-12-4-5-13-20/h2-3,6-11H,4-5,12-14H2,1H3
SMILES:CSc1ccccc1C(=O)c1ccc(cc1)CN1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.