CAS 898776-21-1
:ethyl 7-cyclobutyl-7-oxo-heptanoate
Description:
Ethyl 7-cyclobutyl-7-oxo-heptanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a heptanoate backbone, indicating it has a seven-carbon chain, with a cyclobutyl group and a ketone (oxo) functional group at the seventh carbon position. The presence of the cyclobutyl ring introduces a degree of rigidity and can influence the compound's reactivity and physical properties, such as boiling point and solubility. As an ester, it is likely to exhibit fruity or sweet odors, typical of many esters, and may be used in flavoring or fragrance applications. Additionally, the compound's structure suggests potential applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, making it a subject of interest in various chemical research fields.
Formula:C13H22O3
InChI:InChI=1/C13H22O3/c1-2-16-13(15)10-5-3-4-9-12(14)11-7-6-8-11/h11H,2-10H2,1H3
SMILES:CCOC(=O)CCCCCC(=O)C1CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.