CAS 898776-23-3

Methanone, [4-(methylthio)phenyl][4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, [4-(methylthio)phenyl][4-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings. One of the phenyl rings is substituted with a methylthio group, while the other features a pyrrolidinylmethyl substituent, contributing to its potential biological activity. This compound is likely to exhibit properties typical of ketones, such as being a polar molecule, which can influence its solubility in various solvents. The presence of the pyrrolidine moiety may also suggest potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the methylthio group can enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, the unique combination of functional groups in this compound may lead to diverse applications in research, particularly in the fields of drug development and organic synthesis. However, specific safety and handling information should be consulted from reliable sources due to the potential hazards associated with chemical compounds.

Formula: C₁₉H₂₁NOS

InChI: InChI=1S/C19H21NOS/c1-22-18-10-8-17(9-11-18)19(21)16-6-4-15(5-7-16)14-20-12-2-3-13-20/h4-11H,2-3,12-14H2,1H3

InChI key: InChIKey=AVWCROJZLJYFJD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(SC)C=C3

Synonyms:

• [4-(Methylsulfanyl)phenyl][4-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, [4-(methylthio)phenyl][4-(1-pyrrolidinylmethyl)phenyl]-

4-pyrrolidinomethyl-4′-thiomethylbenzophenone

CAS: 898776-23-3

Formula: C₁₉H₂₁NOS

Purity: 97.0%

Molecular weight: 311.44

Ref: 10-F204327