CymitQuimica logo

CAS 898776-24-4

:

ethyl 8-cyclobutyl-8-oxo-octanoate

Description:
Ethyl 8-cyclobutyl-8-oxo-octanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (in this case, ethanol) and a carboxylic acid. The structure features a cyclobutyl group, contributing to its cyclic nature, and an oxo group (a carbonyl group) at the 8-position of the octanoate chain, which enhances its reactivity and potential applications in organic synthesis. This compound is likely to exhibit moderate polarity due to the presence of both the ester and carbonyl functionalities, influencing its solubility in various organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of the cyclobutyl ring may impart unique steric and electronic properties, making it of interest for further research in medicinal chemistry or materials science. As with many organic compounds, safety and handling precautions should be observed, given the potential for reactivity and toxicity associated with certain functional groups.
Formula:C14H24O3
InChI:InChI=1/C14H24O3/c1-2-17-14(16)11-6-4-3-5-10-13(15)12-8-7-9-12/h12H,2-11H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)C1CCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.