CAS 898776-26-6

Methanone, (3-bromophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3-bromophenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom at the 3-position of one phenyl ring contributes to its reactivity and potential applications in various chemical reactions. The compound also features a pyrrolidinylmethyl substituent, which introduces a nitrogen-containing heterocycle, enhancing its biological activity and solubility properties. This compound may exhibit interesting pharmacological properties due to the combination of the aromatic systems and the nitrogen-containing group, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. As with many organic compounds, its stability, solubility, and reactivity will depend on environmental conditions such as temperature and pH. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.

Formula: C₁₈H₁₈BrNO

InChI: InChI=1S/C18H18BrNO/c19-17-5-3-4-16(12-17)18(21)15-8-6-14(7-9-15)13-20-10-1-2-11-20/h3-9,12H,1-2,10-11,13H2

InChI key: InChIKey=FQYIACAPGNKMJT-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• 3-Bromo-4′-pyrrolidinomethyl benzophenone
• Methanone, (3-bromophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• (3-Bromophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone