CAS 898776-29-9

Methanone, (4-bromophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (4-bromophenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings. The presence of a bromine atom on one of the phenyl rings contributes to its reactivity and potential applications in various chemical reactions. The compound also features a pyrrolidinylmethyl substituent, which introduces a nitrogen-containing heterocycle, enhancing its biological activity and solubility properties. This compound is likely to exhibit significant pharmacological potential, making it of interest in medicinal chemistry. Its molecular structure suggests that it may interact with biological targets, potentially influencing neurotransmitter systems or other cellular pathways. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.

Formula: C₁₈H₁₈BrNO

InChI: InChI=1S/C18H18BrNO/c19-17-9-7-16(8-10-17)18(21)15-5-3-14(4-6-15)13-20-11-1-2-12-20/h3-10H,1-2,11-13H2

InChI key: InChIKey=CBQYQXBIDBDXMK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(Br)C=C3

Synonyms:

• (4-Bromophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (4-bromophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• 4-Bromo-4′-pyrrolidinomethyl benzophenone