CAS 898776-32-4

(3-Chlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone

Description:

(3-Chlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone, identified by its CAS number 898776-32-4, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a pyrrolidinylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the chlorophenyl moiety may influence its lipophilicity and reactivity, while the pyrrolidine ring can impart specific steric and electronic characteristics. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may interact with various biological targets, making it of interest in drug discovery and development. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography for structural confirmation. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₈H₁₈ClNO

InChI: InChI=1S/C18H18ClNO/c19-17-5-3-4-16(12-17)18(21)15-8-6-14(7-9-15)13-20-10-1-2-11-20/h3-9,12H,1-2,10-11,13H2

InChI key: InChIKey=UVKZZQWHCZLWLJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• (3-Chlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone
• 3-Chloro-4′-pyrrolidinomethyl benzophenone
• Methanone, (3-chlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

3-chloro-4′-pyrrolidinomethyl benzophenone

CAS: 898776-32-4

Formula: C₁₈H₁₈ClNO

Purity: 97.0%

Molecular weight: 299.8

Ref: 10-F204330