CymitQuimica logo

CAS 898776-36-8

:

Ethyl η-oxocyclopropaneoctanoate

Description:
Ethyl η-oxocyclopropaneoctanoate, identified by its CAS number 898776-36-8, is an organic compound characterized by its unique structure that includes a cyclopropane ring and an ester functional group. This compound typically exhibits properties common to esters, such as being a colorless liquid with a pleasant, fruity odor. Its molecular structure suggests it may have moderate polarity due to the presence of the ester group, which can influence its solubility in various solvents. Ethyl η-oxocyclopropaneoctanoate may also demonstrate reactivity typical of esters, including hydrolysis under acidic or basic conditions. The compound's cyclopropane moiety may impart strain, potentially affecting its stability and reactivity. Additionally, it may have applications in organic synthesis or as a flavoring agent, depending on its sensory properties. However, specific data regarding its boiling point, melting point, and other physical properties would require further investigation or experimental determination.
Formula:C13H22O3
InChI:InChI=1S/C13H22O3/c1-2-16-13(15)8-6-4-3-5-7-12(14)11-9-10-11/h11H,2-10H2,1H3
InChI key:InChIKey=OBLTUUKSOKLFNO-UHFFFAOYSA-N
SMILES:C(CCCCCCC(OCC)=O)(=O)C1CC1
Synonyms:
  • Ethyl η-oxocyclopropaneoctanoate
  • Cyclopropaneoctanoic acid, η-oxo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.