CAS 898776-38-0
:(4-fluorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (4-fluorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898776-38-0, is a synthetic organic compound characterized by its complex structure, which includes a fluorinated phenyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. The pyrrolidine ring adds to the compound's structural diversity, potentially affecting its pharmacokinetics and pharmacodynamics. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, such as solubility, melting point, and reactivity, would depend on the compound's molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that may exhibit interesting biological properties, warranting further investigation in drug discovery and development.
Formula:C18H18FNO
InChI:InChI=1/C18H18FNO/c19-17-9-7-16(8-10-17)18(21)15-5-3-14(4-6-15)13-20-11-1-2-12-20/h3-10H,1-2,11-13H2
SMILES:C1CCN(C1)Cc1ccc(cc1)C(=O)c1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.