CAS 898776-40-4
:1-(3,4-difluorophenyl)-3-(4-methoxyphenyl)propan-1-one
Description:
1-(3,4-Difluorophenyl)-3-(4-methoxyphenyl)propan-1-one, with the CAS number 898776-40-4, is an organic compound characterized by its unique structure that includes a propanone backbone substituted with both a difluorophenyl and a methoxyphenyl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. The presence of fluorine atoms in the difluorophenyl group can enhance the compound's lipophilicity and potentially influence its biological activity, making it of interest in pharmaceutical research. The methoxy group contributes to the compound's overall polarity and can affect its solubility in various solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic rings and the carbonyl group, which could be relevant in applications such as organic electronics or as a precursor in synthetic chemistry. Overall, this compound's unique structural features suggest potential utility in various chemical and medicinal applications.
Formula:C16H14F2O2
InChI:InChI=1/C16H14F2O2/c1-20-13-6-2-11(3-7-13)4-9-16(19)12-5-8-14(17)15(18)10-12/h2-3,5-8,10H,4,9H2,1H3
SMILES:COc1ccc(cc1)CCC(=O)c1ccc(c(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.