CAS 898776-44-8

(2,4-dimethylphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:

The chemical substance known as (2,4-dimethylphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898776-44-8, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a pyrrolidine moiety, indicating potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests it may exhibit interesting biological activities, possibly acting as a ligand for various receptors or enzymes. The presence of the pyrrolidine ring may enhance its solubility and bioavailability. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings, which may affect its interaction with biological targets. As with many synthetic compounds, safety and handling precautions are essential, and further studies would be necessary to fully elucidate its pharmacological properties and potential applications in drug development.

Formula: C₂₀H₂₃NO

InChI: InChI=1/C20H23NO/c1-15-5-10-19(16(2)13-15)20(22)18-8-6-17(7-9-18)14-21-11-3-4-12-21/h5-10,13H,3-4,11-12,14H2,1-2H3

SMILES: Cc1ccc(c(C)c1)C(=O)c1ccc(cc1)CN1CCCC1