CymitQuimica logo

CAS 898776-47-1

:

(2,5-dimethylphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:
The chemical substance known as (2,5-dimethylphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898776-47-1, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a pyrrolidine moiety, indicating potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests it may exhibit interesting biological activities, possibly acting as a ligand or modulator in various biochemical pathways. The presence of the pyrrolidine ring may enhance its solubility and bioavailability, making it a candidate for further research in drug design. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings, which may affect its interaction with biological targets. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, although specific biological activity and safety profiles would require thorough investigation through experimental studies.
Formula:C20H23NO
InChI:InChI=1/C20H23NO/c1-15-5-6-16(2)19(13-15)20(22)18-9-7-17(8-10-18)14-21-11-3-4-12-21/h5-10,13H,3-4,11-12,14H2,1-2H3
SMILES:Cc1ccc(C)c(c1)C(=O)c1ccc(cc1)CN1CCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.