CymitQuimica logo

CAS 898776-52-8

:

ethyl 6,6,6-trifluoro-5-oxo-hexanoate

Description:
Ethyl 6,6,6-trifluoro-5-oxo-hexanoate is an organic compound characterized by its ester functional group, which is derived from hexanoic acid and ethanol. The presence of three fluorine atoms at the 6-position of the hexanoate chain significantly influences its chemical properties, including increased lipophilicity and altered reactivity. The compound features a ketone functional group at the 5-position, contributing to its potential as a reactive intermediate in various chemical reactions. Ethyl 6,6,6-trifluoro-5-oxo-hexanoate is typically a colorless to pale yellow liquid, exhibiting a distinctive odor. Its molecular structure allows for various applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The trifluoromethyl group enhances its biological activity and stability, making it a valuable compound in medicinal chemistry. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit unique toxicological profiles. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C8H11F3O3
InChI:InChI=1/C8H11F3O3/c1-2-14-7(13)5-3-4-6(12)8(9,10)11/h2-5H2,1H3
SMILES:CCOC(=O)CCCC(=O)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.