CAS 898776-53-9
:Methanone, (3,5-dimethylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
Description:
Methanone, (3,5-dimethylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 3,5-dimethylphenyl group indicates that the compound has two methyl substituents on the phenyl ring, contributing to its hydrophobic characteristics and potentially influencing its reactivity and interactions. The 4-(1-pyrrolidinylmethyl)phenyl moiety introduces a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, adding to the compound's potential biological activity and solubility properties. This compound may exhibit interesting pharmacological properties due to the combination of aromatic and aliphatic structures, making it a candidate for research in medicinal chemistry. Its CAS number, 898776-53-9, allows for easy identification in chemical databases. Overall, the unique structural features of this compound suggest potential applications in various fields, including pharmaceuticals and materials science.
Formula:C20H23NO
InChI:InChI=1/C20H23NO/c1-15-11-16(2)13-19(12-15)20(22)18-7-5-17(6-8-18)14-21-9-3-4-10-21/h5-8,11-13H,3-4,9-10,14H2,1-2H3
InChI key:InChIKey=KXXYFFOYLJWJFN-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=CC(C)=C1)C2=CC=C(CN3CCCC3)C=C2
Synonyms:- Methanone, (3,5-dimethylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
- (3,5-Dimethylphenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone
- (3,5-dimethylphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone
- 3,5-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.