CAS 898776-55-1
:(4-bromo-3-fluoro-phenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (4-bromo-3-fluoro-phenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898776-55-1, is a synthetic organic compound characterized by its complex molecular structure. It features a phenyl ring substituted with both bromine and fluorine atoms, which can influence its reactivity and biological activity. The presence of a pyrrolidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can affect its solubility and permeability in biological systems. Additionally, the methanone functional group indicates the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic attacks. Overall, the unique combination of substituents in this compound may contribute to its potential applications in pharmaceuticals or as a research chemical, although specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C18H17BrFNO
InChI:InChI=1/C18H17BrFNO/c19-16-8-7-15(11-17(16)20)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2
SMILES:C1CCN(C1)Cc1ccc(cc1)C(=O)c1ccc(c(c1)F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.