CAS 898776-56-2

Ethyl 4-(2-phenylacetyl)benzoate

Description:

Ethyl 4-(2-phenylacetyl)benzoate, identified by its CAS number 898776-56-2, is an organic compound that belongs to the class of esters. It features a benzoate moiety with an ethyl group and a phenylacetyl substituent, contributing to its unique chemical structure. This compound is typically characterized by its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic nature. Ethyl 4-(2-phenylacetyl)benzoate may exhibit various functional properties, including potential applications in the fields of pharmaceuticals, fragrance, and flavoring due to its aromatic characteristics. The presence of the phenylacetyl group can influence its reactivity and interaction with biological systems. Additionally, it may undergo typical ester reactions, such as hydrolysis and transesterification, under appropriate conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a versatile structure with implications in both synthetic chemistry and industrial applications.

Formula: C₁₇H₁₆O₃

InChI: InChI=1S/C17H16O3/c1-2-20-17(19)15-10-8-14(9-11-15)16(18)12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3

InChI key: InChIKey=CMXZPAUMRMYUIQ-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)(=O)C2=CC=C(C(OCC)=O)C=C2

Synonyms:

• Benzoic acid, 4-(2-phenylacetyl)-, ethyl ester
• Ethyl 4-(2-phenylacetyl)benzoate

Ethyl 4-(2-phenylacetyl)benzoate

CAS: 898776-56-2

Ethyl 4-(2-phenylacetyl)benzoate

Purity: 95%

Molecular weight: 268.31g/mol

Ref: 54-OR1051556