CAS 898776-63-1
:(2-fluorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (2-fluorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898776-63-1, is characterized by its complex molecular structure, which includes a fluorinated phenyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity, making it of interest in medicinal chemistry. The pyrrolidine ring adds to the compound's steric and electronic properties, potentially affecting its binding affinity to biological targets. As a ketone, it may also participate in various chemical reactions, such as nucleophilic additions. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or as a chemical intermediate, although specific biological activities and physical properties would require empirical investigation for comprehensive understanding.
Formula:C18H18FNO
InChI:InChI=1/C18H18FNO/c19-17-6-2-1-5-16(17)18(21)15-9-7-14(8-10-15)13-20-11-3-4-12-20/h1-2,5-10H,3-4,11-13H2
SMILES:c1ccc(c(c1)C(=O)c1ccc(cc1)CN1CCCC1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.