CymitQuimica logo

CAS 898776-66-4

:

ethyl 2-phenacylbenzoate

Description:
Ethyl 2-phenacylbenzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of phenacylbenzoic acid and ethanol. It typically appears as a colorless to pale yellow liquid with a pleasant aromatic odor. The compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Ethyl 2-phenacylbenzoate is known for its potential applications in the fields of organic synthesis and as a fragrance or flavoring agent due to its aromatic properties. Its molecular structure includes a phenacyl group, which contributes to its reactivity and potential use in various chemical reactions, including those involving nucleophilic substitutions. As with many organic compounds, safety precautions should be observed when handling ethyl 2-phenacylbenzoate, as it may pose health risks if ingested or inhaled. Overall, this compound exemplifies the diverse functionalities of esters in organic chemistry.
Formula:C17H16O3
InChI:InChI=1/C17H16O3/c1-2-20-17(19)15-11-7-6-10-14(15)12-16(18)13-8-4-3-5-9-13/h3-11H,2,12H2,1H3
SMILES:CCOC(=O)c1ccccc1CC(=O)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.