CAS 898776-67-5

Methanone, [4-(1-pyrrolidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]-

Description:

Methanone, [4-(1-pyrrolidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. One of the rings is substituted with a pyrrolidinylmethyl group, while the other features a trifluoromethyl group, contributing to its unique chemical properties. This compound is likely to exhibit significant lipophilicity due to the presence of the trifluoromethyl group, which can enhance its biological activity and interaction with various biological targets. The pyrrolidinyl moiety may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups suggests potential for diverse reactivity and applications in organic synthesis. As with many compounds containing fluorine, it may exhibit stability under various conditions, but its reactivity can vary based on the surrounding environment and the presence of other functional groups. Overall, this compound's unique structural features position it as a candidate for further research in drug development and chemical synthesis.

Formula: C₁₉H₁₈F₃NO

InChI: InChI=1S/C19H18F3NO/c20-19(21,22)17-5-3-4-16(12-17)18(24)15-8-6-14(7-9-15)13-23-10-1-2-11-23/h3-9,12H,1-2,10-11,13H2

InChI key: InChIKey=UUPZRPZSDNQHGA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C(F)(F)F)=CC=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• [4-(1-Pyrrolidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]methanone
• 4′-Pyrrolidinomethyl-3-trifluoromethylbenzophenone
• Methanone, [4-(1-pyrrolidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]-

4′-pyrrolidinomethyl-3-trifluoromethylbenzophenone

CAS: 898776-67-5

Formula: C₁₉H₁₈F₃NO

Purity: 97.0%

Molecular weight: 333.354

Ref: 10-F204346