CAS 898776-68-6
:ethyl 3-propanoylbenzoate
Description:
Ethyl 3-propanoylbenzoate, identified by its CAS number 898776-68-6, is an organic compound that belongs to the class of esters. It is characterized by the presence of an ethyl group, a benzoate moiety, and a propanoyl group, which contribute to its unique chemical structure and properties. This compound typically appears as a colorless to pale yellow liquid with a pleasant, fruity aroma, making it potentially useful in flavoring and fragrance applications. Ethyl 3-propanoylbenzoate is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic nature. Its chemical behavior is influenced by the ester functional group, which can undergo hydrolysis in the presence of acids or bases, leading to the formation of the corresponding carboxylic acid and alcohol. Additionally, it may participate in various organic reactions, including transesterification and acylation, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C12H14O3
InChI:InChI=1/C12H14O3/c1-3-11(13)9-6-5-7-10(8-9)12(14)15-4-2/h5-8H,3-4H2,1-2H3
SMILES:CCC(=O)c1cccc(c1)C(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.