CymitQuimica logo

CAS 898776-71-1

:

(4-bromo-2-fluoro-phenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:
The chemical substance known as (4-bromo-2-fluoro-phenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898776-71-1, is a synthetic organic compound characterized by its complex structure that includes both aromatic and aliphatic components. It features a phenyl ring substituted with a bromine and a fluorine atom, which can influence its electronic properties and reactivity. The presence of a pyrrolidine moiety suggests potential interactions with biological systems, making it of interest in medicinal chemistry. This compound may exhibit specific pharmacological activities due to its structural features, which can affect its binding affinity to various biological targets. Additionally, the methanone functional group indicates the presence of a carbonyl group, contributing to its reactivity and potential applications in organic synthesis. Overall, this compound's unique combination of substituents and functional groups positions it as a candidate for further research in drug development and chemical applications.
Formula:C18H17BrFNO
InChI:InChI=1/C18H17BrFNO/c19-15-7-8-16(17(20)11-15)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2
SMILES:C1CCN(C1)Cc1ccc(cc1)C(=O)c1ccc(cc1F)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.