CymitQuimica logo

CAS 898776-77-7

:

(4-chloro-2-fluoro-phenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:
The chemical substance known as (4-chloro-2-fluoro-phenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898776-77-7, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chloro and fluoro groups, as well as a pyrrolidine moiety. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic rings, which can influence its solubility in organic solvents. The presence of halogen atoms (chlorine and fluorine) can enhance its biological activity and stability. Additionally, the pyrrolidine group may contribute to its potential as a pharmacophore in medicinal chemistry, possibly affecting its interaction with biological targets. The compound's molecular structure suggests potential applications in drug development, particularly in areas related to neuropharmacology or as a scaffold for further chemical modifications. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies.
Formula:C18H17ClFNO
InChI:InChI=1/C18H17ClFNO/c19-15-7-8-16(17(20)11-15)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.