CAS 898776-81-3
:Methanone, (2,4-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
Description:
Methanone, (2,4-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,4-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. The 4-(1-pyrrolidinylmethyl)phenyl moiety suggests that the compound has a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, contributing to its potential pharmacological properties. This compound may exhibit various characteristics such as lipophilicity due to its aromatic components, which can affect its solubility and permeability in biological systems. Additionally, the presence of halogen atoms like chlorine can enhance the compound's stability and alter its interaction with biological targets. Overall, this compound's unique structure may lead to interesting applications in medicinal chemistry, particularly in the development of pharmaceuticals.
Formula:C18H17Cl2NO
InChI:InChI=1S/C18H17Cl2NO/c19-15-7-8-16(17(20)11-15)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2
InChI key:InChIKey=ICBAZHXNLIPZBN-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(Cl)C=C1)C2=CC=C(CN3CCCC3)C=C2
Synonyms:- Methanone, (2,4-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
- (2,4-Dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone
- 2,4-Dichloro-4′-pyrrolidinomethyl benzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.