CAS 898776-83-5

Methanone, (2,5-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl and pyrrolidinylmethyl groups suggests that it may exhibit significant biological activity, potentially interacting with various biological targets. This compound is likely to be a solid at room temperature, given its structural characteristics, and may have moderate solubility in organic solvents. Its molecular structure indicates potential for use in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrrolidine moiety, which is often associated with neuroactive properties. Additionally, the dichlorophenyl group may enhance lipophilicity, influencing its pharmacokinetic profile. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, including its stability, reactivity, and biological effects.

Formula: C₁₈H₁₇Cl₂NO

InChI: InChI=1S/C18H17Cl2NO/c19-15-7-8-17(20)16(11-15)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2

InChI key: InChIKey=FHUFVBWDHVGEOW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC(Cl)=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• Methanone, (2,5-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• (2,5-Dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone
• 2,5-Dichloro-4′-pyrrolidinomethyl benzophenone

2,5-dichloro-4′-pyrrolidinomethyl benzophenone

CAS: 898776-83-5

Formula: C₁₈H₁₇Cl₂NO

Purity: 97.0%

Molecular weight: 334.24

Ref: 10-F204354