CAS 898776-85-7

Methanone, (3,4-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3,4-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. The pyrrolidinylmethyl substituent suggests that the compound may exhibit properties associated with cyclic amines, potentially impacting its pharmacological profile. This compound is likely to be lipophilic due to its aromatic components, which may affect its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups may contribute to its potential as a ligand in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. As with many synthetic compounds, understanding its safety, toxicity, and environmental impact is crucial for its application in research or industry.

Formula: C₁₈H₁₇Cl₂NO

InChI: InChI=1S/C18H17Cl2NO/c19-16-8-7-15(11-17(16)20)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2

InChI key: InChIKey=NDQJXLNZTMBMRX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCC2)C=C1)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• Methanone, (3,4-dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• 3,4-Dichloro-4′-pyrrolidinomethyl benzophenone
• (3,4-Dichlorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone

3,4-dichloro-4′-pyrrolidinomethyl benzophenone

CAS: 898776-85-7

Formula: C₁₈H₁₇Cl₂NO

Purity: 97.0%

Molecular weight: 334.24

Ref: 10-F204355