CAS 898776-89-1

Methanone, (2,4-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2,4-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the difluorophenyl group indicates that the compound has two fluorine substituents on the phenyl ring, which can influence its reactivity and physical properties, such as polarity and boiling point. The pyrrolidinylmethyl substituent introduces a cyclic amine, contributing to the compound's potential biological activity and solubility characteristics. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the electron-withdrawing effects of the fluorine atoms and the steric effects of the bulky aromatic groups. Overall, the unique combination of functional groups and substituents in this compound suggests potential applications in drug development and other chemical research areas.

Formula: C₁₈H₁₇F₂NO

InChI: InChI=1S/C18H17F2NO/c19-15-7-8-16(17(20)11-15)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2

InChI key: InChIKey=VICGPFJZPKCRNA-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• Methanone, (2,4-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• 2,4-Difluoro-4′-pyrrolidinomethyl benzophenone
• (2,4-Difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone