CAS 898776-91-5

Methanone, (3,4-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3,4-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the difluorophenyl group indicates that the compound has two fluorine atoms substituted on the phenyl ring, which can influence its electronic properties and reactivity. The pyrrolidinylmethyl substituent suggests that the compound may exhibit certain biological activities, potentially interacting with various biological targets due to the presence of the nitrogen-containing pyrrolidine ring. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic nature. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. As with many synthetic organic compounds, safety and handling precautions are essential, as it may exhibit toxicity or other hazardous characteristics. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₈H₁₇F₂NO

InChI: InChI=1S/C18H17F2NO/c19-16-8-7-15(11-17(16)20)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2

InChI key: InChIKey=AMAQRLIZIIEDHT-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCC2)C=C1)C3=CC(F)=C(F)C=C3

Synonyms:

• (3,4-Difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (3,4-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• 3,4-Difluoro-4′-pyrrolidinomethyl benzophenone