CAS 898776-93-7

Methanone, (3,5-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3,5-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-difluorophenyl group indicates that the compound has two fluorine atoms substituted on the phenyl ring, which can influence its electronic properties and reactivity. The 4-(1-pyrrolidinylmethyl)phenyl moiety suggests that there is a pyrrolidine ring attached to another phenyl group, contributing to the compound's potential biological activity. This structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular interactions, solubility, and stability can be affected by the presence of fluorine atoms and the pyrrolidine group, which may enhance lipophilicity and alter binding affinities in biological systems. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various applications, including drug development and research.

Formula: C₁₈H₁₇F₂NO

InChI: InChI=1S/C18H17F2NO/c19-16-9-15(10-17(20)11-16)18(22)14-5-3-13(4-6-14)12-21-7-1-2-8-21/h3-6,9-11H,1-2,7-8,12H2

InChI key: InChIKey=KRRCOINVEADLGF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(CN3CCCC3)C=C2

Synonyms:

• Methanone, (3,5-difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]-
• (3,5-Difluorophenyl)[4-(1-pyrrolidinylmethyl)phenyl]methanone
• 3,5-Difluoro-4′-pyrrolidinomethyl benzophenone