CymitQuimica logo

CAS 898776-95-9

:

[4-(pyrrolidin-1-ylmethyl)phenyl]-(3,4,5-trifluorophenyl)methanone

Description:
The chemical substance known as [4-(pyrrolidin-1-ylmethyl)phenyl]-(3,4,5-trifluorophenyl)methanone, with the CAS number 898776-95-9, is characterized by its complex molecular structure, which includes a phenyl ring substituted with a pyrrolidine moiety and a trifluorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the trifluoromethyl groups enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The pyrrolidine ring can impart specific steric and electronic effects, which may affect the compound's interaction with biological targets. Additionally, the compound may exhibit unique thermal and stability properties due to its structural features. Overall, this substance is likely to be studied for its potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis.
Formula:C18H16F3NO
InChI:InChI=1/C18H16F3NO/c19-15-9-14(10-16(20)17(15)21)18(23)13-5-3-12(4-6-13)11-22-7-1-2-8-22/h3-6,9-10H,1-2,7-8,11H2
SMILES:C1CCN(C1)Cc1ccc(cc1)C(=O)c1cc(c(c(c1)F)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.