CAS 898776-97-1
:Cyclopropyl[4-(1-pyrrolidinylmethyl)phenyl]methanone
Description:
Cyclopropyl[4-(1-pyrrolidinylmethyl)phenyl]methanone, identified by its CAS number 898776-97-1, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity, and a phenyl ring substituted with a pyrrolidinylmethyl group. This structure suggests potential biological activity, as the presence of the pyrrolidine moiety can influence interactions with biological targets, possibly enhancing its pharmacological properties. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic and cyclopropyl components, which may affect its solubility and permeability in biological systems. Additionally, the presence of a ketone functional group contributes to its reactivity, potentially allowing for further chemical modifications. Overall, the characteristics of this compound suggest it may be of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C15H19NO
InChI:InChI=1S/C15H19NO/c17-15(14-7-8-14)13-5-3-12(4-6-13)11-16-9-1-2-10-16/h3-6,14H,1-2,7-11H2
InChI key:InChIKey=PRDAMARAVUUARY-UHFFFAOYSA-N
SMILES:C(=O)(C1CC1)C2=CC=C(CN3CCCC3)C=C2
Synonyms:- Methanone, cyclopropyl[4-(1-pyrrolidinylmethyl)phenyl]-
- Cyclopropyl[4-(1-pyrrolidinylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.