CAS 898777-04-3

Cyclohexyl[4-(1-pyrrolidinylmethyl)phenyl]methanone

Description:

Cyclohexyl[4-(1-pyrrolidinylmethyl)phenyl]methanone, identified by its CAS number 898777-04-3, is a synthetic organic compound characterized by its complex structure that includes a cyclohexyl group, a phenyl ring, and a pyrrolidine moiety. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic cyclohexyl and phenyl components. The presence of the pyrrolidine group suggests potential biological activity, as pyrrolidine derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, the compound may exhibit moderate to high stability under standard conditions, but like many organic compounds, it should be handled with care to avoid degradation or reaction with strong oxidizing agents. Overall, its unique structure may lend itself to various applications in research and development, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₁₈H₂₅NO

InChI: InChI=1S/C18H25NO/c20-18(16-6-2-1-3-7-16)17-10-8-15(9-11-17)14-19-12-4-5-13-19/h8-11,16H,1-7,12-14H2

InChI key: InChIKey=VQAYWKUGGJTVOB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCC2)C=C1)C3CCCCC3

Synonyms:

• Methanone, cyclohexyl[4-(1-pyrrolidinylmethyl)phenyl]-
• Cyclohexyl[4-(1-pyrrolidinylmethyl)phenyl]methanone