CAS 898777-13-4

Ethyl ε-oxo-4-(1-pyrrolidinylmethyl)benzenehexanoate

Description:

Ethyl ε-oxo-4-(1-pyrrolidinylmethyl)benzenehexanoate, identified by its CAS number 898777-13-4, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group, a ketone, and a pyrrolidine moiety. This compound typically exhibits moderate to high lipophilicity due to its hydrophobic aromatic and aliphatic components, which may influence its solubility in organic solvents. The presence of the pyrrolidine ring suggests potential biological activity, as such structures are often found in pharmacologically active compounds. Ethyl ε-oxo-4-(1-pyrrolidinylmethyl)benzenehexanoate may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a versatile intermediate in organic synthesis. Its stability and reactivity can be influenced by factors such as pH and temperature. While specific applications may vary, compounds of this nature are often explored in medicinal chemistry and materials science for their potential therapeutic properties or as building blocks in the synthesis of more complex molecules.

Formula: C₁₉H₂₇NO₃

InChI: InChI=1S/C19H27NO3/c1-2-23-19(22)8-4-3-7-18(21)17-11-9-16(10-12-17)15-20-13-5-6-14-20/h9-12H,2-8,13-15H2,1H3

InChI key: InChIKey=AOWSJRVVAUCUBN-UHFFFAOYSA-N

SMILES: C(C1=CC=C(C(CCCCC(OCC)=O)=O)C=C1)N2CCCC2

Synonyms:

• Ethyl ε-oxo-4-(1-pyrrolidinylmethyl)benzenehexanoate
• Benzenehexanoic acid, ε-oxo-4-(1-pyrrolidinylmethyl)-, ethyl ester

ethyl 6-oxo-6-[(4-pyrrolidinomthyl)phenyl]hexanoate

CAS: 898777-13-4

Formula: C₁₉H₂₇NO₃

Purity: 97.0%

Molecular weight: 317.429

Ref: 10-F204367