CAS 898777-15-6
:Ethyl 2-iodo-ε-oxobenzenehexanoate
Description:
Ethyl 2-iodo-ε-oxobenzenehexanoate, with the CAS number 898777-15-6, is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol and a carboxylic acid. This compound features a hexanoate chain, indicating it has a six-carbon backbone, and an iodo substituent at the second position of the aromatic ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the oxo group (a carbonyl group) suggests that it may participate in various chemical reactions, such as nucleophilic additions or substitutions. Ethyl 2-iodo-ε-oxobenzenehexanoate is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its unique structure may make it useful in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many halogenated compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C14H17IO3
InChI:InChI=1/C14H17IO3/c1-2-18-14(17)10-6-5-9-13(16)11-7-3-4-8-12(11)15/h3-4,7-8H,2,5-6,9-10H2,1H3
InChI key:InChIKey=PBAMPYGSSRIGPA-UHFFFAOYSA-N
SMILES:C(CCCCC(OCC)=O)(=O)C1=C(I)C=CC=C1
Synonyms:- Benzenehexanoic acid, 2-iodo-ε-oxo-, ethyl ester
- Ethyl 2-iodo-ε-oxobenzenehexanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.