CAS 898777-24-7
:ethyl 4-(3-iodophenyl)-4-oxo-butanoate
Description:
Ethyl 4-(3-iodophenyl)-4-oxo-butanoate is an organic compound characterized by its ester functional group and a ketone moiety. The presence of the 3-iodophenyl group introduces significant polarity and potential for various chemical reactions, including electrophilic substitutions due to the electron-withdrawing nature of the iodine atom. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic characteristics of the aromatic ring. The molecular structure suggests that it may participate in reactions such as nucleophilic attacks or condensation reactions, making it of interest in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, which could be explored for potential applications in pharmaceuticals or agrochemicals. Its stability under standard conditions is generally good, but it should be handled with care due to the presence of iodine, which can pose health risks. Overall, ethyl 4-(3-iodophenyl)-4-oxo-butanoate is a versatile compound with potential applications in various fields of chemistry.
Formula:C12H13IO3
InChI:InChI=1/C12H13IO3/c1-2-16-12(15)7-6-11(14)9-4-3-5-10(13)8-9/h3-5,8H,2,6-7H2,1H3
SMILES:CCOC(=O)CCC(=O)c1cccc(c1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.