CAS 898777-25-8
:Methanone, [4-(1-azetidinylmethyl)phenyl](2-methylphenyl)-
Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](2-methylphenyl)-, also known by its CAS number 898777-25-8, is a chemical compound characterized by its unique structure that includes a methanone functional group and an azetidine ring. This compound features a phenyl group substituted with a 1-azetidinylmethyl moiety, which contributes to its potential biological activity. The presence of a 2-methylphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. Methanone derivatives often exhibit interesting pharmacological properties, making them subjects of research in medicinal chemistry. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic attacks due to the electrophilic nature of the carbonyl group. Additionally, its stereochemistry and functional groups may play a significant role in determining its reactivity and interaction with other molecules. Overall, this compound represents a class of organic molecules that could have applications in drug development and other fields of chemistry.
Formula:C18H19NO
InChI:InChI=1/C18H19NO/c1-14-5-2-3-6-17(14)18(20)16-9-7-15(8-10-16)13-19-11-4-12-19/h2-3,5-10H,4,11-13H2,1H3
InChI key:InChIKey=UCDAFGLFHOMHNH-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=CC=C1)C2=CC=C(CN3CCC3)C=C2
Synonyms:- Methanone, [4-(1-azetidinylmethyl)phenyl](2-methylphenyl)-
- [4-(1-Azetidinylmethyl)phenyl](2-methylphenyl)methanone
- (4-(Azetidin-1-ylmethyl)phenyl)(o-tolyl)methanone
- 4'-AZETIDINOMETHYL-2-METHYLBENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.